| You need a browser with JavaScript support in order to view the molecule in 3D |
|
Transitions — Left-clk & drag: Zoom; Right-clk: reset |
| Number of atoms | 27 |
|---|---|
| Weight | 227.0735 amu |
| Total energy | -707.8414 Hartree |
| Zero-point energy | 128.5334 Kcal/mol |
| Method | B3LYP/N07D |
| State | c1 |
| Solo hydrogens | 0 |
| Duo hydrogens | 6 |
| Trio hydrogens | 3 |
| Quartet hydrogens | 0 |
| Quintet hydrogens | 0 |
| CH | 0 |
| CH2 | 0 |
| CH3 | 0 |
| smiles | c12c3c4ccc1ccc(c2ccc3ccc4)[N]#[C-] |
You are kindly asked to consider the following references for citation when using the database:
Comment(s)